C21H22N2O6 — CID 4815913
3-(4,5-dimethoxy-2-nitrophenyl)-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one (PubChem CID 4815913) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-nitrophenyl)-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one.
| Compound Name | 3-(4,5-dimethoxy-2-nitrophenyl)-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4815913 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3-(4,5-dimethoxy-2-nitrophenyl)-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc(N3CCOCC3)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H22N2O6/c1-27-20-13-16(18(23(25)26)14-21(20)28-2)5-8-19(24)15-3-6-17(7-4-15)22-9-11-29-12-10-22/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | CGHCNUUYJIFBNK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|