C15H12BrNO5S — CID 8833244
(E)-1-(5-bromothiophen-2-yl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-en-1-one (PubChem CID 8833244) has the molecular formula C15H12BrNO5S and a molecular weight of 398.23 g/mol. Its IUPAC name is (E)-1-(5-bromothiophen-2-yl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(5-bromothiophen-2-yl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8833244 |
| Molecular Formula | C15H12BrNO5S |
| Molecular Weight | 398.23 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | (E)-1-(5-bromothiophen-2-yl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(Br)s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H12BrNO5S/c1-21-12-7-9(10(17(19)20)8-13(12)22-2)3-4-11(18)14-5-6-15(16)23-14/h3-8H,1-2H3/b4-3+ |
| InChIKey | BCKYANLDKONCOQ-ONEGZZNKSA-N |
| XLogP | 4.33 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|