C17H12BrF2NO5 — CID 24582561
(E)-1-(4-bromophenyl)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]prop-2-en-1-one (PubChem CID 24582561) has the molecular formula C17H12BrF2NO5 and a molecular weight of 428.19 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 24582561 |
| Molecular Formula | C17H12BrF2NO5 |
| Molecular Weight | 428.19 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(Br)cc2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C17H12BrF2NO5/c1-25-15-8-11(13(21(23)24)9-16(15)26-17(19)20)4-7-14(22)10-2-5-12(18)6-3-10/h2-9,17H,1H3/b7-4+ |
| InChIKey | DTGAVMYZLWRHSA-QPJJXVBHSA-N |
| XLogP | 4.86 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.19 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|