C14H11F2N3O5S — CID 24580410
(E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 24580410) has the molecular formula C14H11F2N3O5S and a molecular weight of 371.32 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 24580410 |
| Molecular Formula | C14H11F2N3O5S |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2nccs2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C14H11F2N3O5S/c1-23-10-6-8(2-3-12(20)18-14-17-4-5-25-14)9(19(21)22)7-11(10)24-13(15)16/h2-7,13H,1H3,(H,17,18,20)/b3-2+ |
| InChIKey | PKSQZLGAFMLUPE-NSCUHMNNSA-N |
| XLogP | 3.31 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|