C11H9F2NO5 — CID 171027878
(E)-3-[2-(difluoromethoxy)-5-methyl-4-nitrophenyl]prop-2-enoic acid (PubChem CID 171027878) has the molecular formula C11H9F2NO5 and a molecular weight of 273.19 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-5-methyl-4-nitrophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(difluoromethoxy)-5-methyl-4-nitrophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171027878 |
| Molecular Formula | C11H9F2NO5 |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-5-methyl-4-nitrophenyl]prop-2-enoic acid |
| SMILES | Cc1cc(/C=C/C(=O)O)c(OC(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9F2NO5/c1-6-4-7(2-3-10(15)16)9(19-11(12)13)5-8(6)14(17)18/h2-5,11H,1H3,(H,15,16)/b3-2+ |
| InChIKey | FHJNZPMZTPXXPL-NSCUHMNNSA-N |
| XLogP | 2.60 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|