C12H10F2O4 — CID 171026502
(E)-3-[2-(difluoromethoxy)-5-formyl-4-methylphenyl]prop-2-enoic acid (PubChem CID 171026502) has the molecular formula C12H10F2O4 and a molecular weight of 256.20 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-5-formyl-4-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(difluoromethoxy)-5-formyl-4-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171026502 |
| Molecular Formula | C12H10F2O4 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-5-formyl-4-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(OC(F)F)c(/C=C/C(=O)O)cc1C=O |
| InChI | InChI=1S/C12H10F2O4/c1-7-4-10(18-12(13)14)8(2-3-11(16)17)5-9(7)6-15/h2-6,12H,1H3,(H,16,17)/b3-2+ |
| InChIKey | KEBRHUMENBSTOE-NSCUHMNNSA-N |
| XLogP | 2.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|