C10H6Cl2F2O3 — CID 119002235
(E)-3-[2,4-dichloro-5-(difluoromethoxy)phenyl]prop-2-enoic acid (PubChem CID 119002235) has the molecular formula C10H6Cl2F2O3 and a molecular weight of 283.06 g/mol. Its IUPAC name is (E)-3-[2,4-dichloro-5-(difluoromethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2,4-dichloro-5-(difluoromethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 119002235 |
| Molecular Formula | C10H6Cl2F2O3 |
| Molecular Weight | 283.06 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | (E)-3-[2,4-dichloro-5-(difluoromethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(OC(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H6Cl2F2O3/c11-6-4-7(12)8(17-10(13)14)3-5(6)1-2-9(15)16/h1-4,10H,(H,15,16)/b2-1+ |
| InChIKey | OBXYQTBWCADYPU-OWOJBTEDSA-N |
| XLogP | 3.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.06 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|