C8H4Cl2F2O3 — CID 119020292
2,4-dichloro-5-(difluoromethoxy)benzoic acid (PubChem CID 119020292) has the molecular formula C8H4Cl2F2O3 and a molecular weight of 257.02 g/mol. Its IUPAC name is 2,4-dichloro-5-(difluoromethoxy)benzoic acid.
| Compound Name | 2,4-dichloro-5-(difluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 119020292 |
| Molecular Formula | C8H4Cl2F2O3 |
| Molecular Weight | 257.02 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 2,4-dichloro-5-(difluoromethoxy)benzoic acid |
| SMILES | O=C(O)c1cc(OC(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H4Cl2F2O3/c9-4-2-5(10)6(15-8(11)12)1-3(4)7(13)14/h1-2,8H,(H,13,14) |
| InChIKey | KLYLDHQPBRBOAQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.02 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |