C12H7F2NO4 — CID 171011272
(E)-3-[3-cyano-4-(difluoromethoxy)-2-formylphenyl]prop-2-enoic acid (PubChem CID 171011272) has the molecular formula C12H7F2NO4 and a molecular weight of 267.19 g/mol. Its IUPAC name is (E)-3-[3-cyano-4-(difluoromethoxy)-2-formylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-cyano-4-(difluoromethoxy)-2-formylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171011272 |
| Molecular Formula | C12H7F2NO4 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (E)-3-[3-cyano-4-(difluoromethoxy)-2-formylphenyl]prop-2-enoic acid |
| SMILES | N#Cc1c(OC(F)F)ccc(/C=C/C(=O)O)c1C=O |
| InChI | InChI=1S/C12H7F2NO4/c13-12(14)19-10-3-1-7(2-4-11(17)18)9(6-16)8(10)5-15/h1-4,6,12H,(H,17,18)/b4-2+ |
| InChIKey | IGCXOXDNZLTIHY-DUXPYHPUSA-N |
| XLogP | 2.07 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|