C11H7F2NO5 — CID 171014777
2-[2-cyano-6-(difluoromethoxy)-3-formylphenyl]-2-hydroxyacetic acid (PubChem CID 171014777) has the molecular formula C11H7F2NO5 and a molecular weight of 271.18 g/mol. Its IUPAC name is 2-[2-cyano-6-(difluoromethoxy)-3-formylphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-cyano-6-(difluoromethoxy)-3-formylphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 171014777 |
| Molecular Formula | C11H7F2NO5 |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-[2-cyano-6-(difluoromethoxy)-3-formylphenyl]-2-hydroxyacetic acid |
| SMILES | N#Cc1c(C=O)ccc(OC(F)F)c1C(O)C(=O)O |
| InChI | InChI=1S/C11H7F2NO5/c12-11(13)19-7-2-1-5(4-15)6(3-14)8(7)9(16)10(17)18/h1-2,4,9,11,16H,(H,17,18) |
| InChIKey | BIJOTJVYOFPAID-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|