C10H7F2NO7 — CID 171027691
2-[6-(difluoromethoxy)-3-formyl-2-nitrophenyl]-2-hydroxyacetic acid (PubChem CID 171027691) has the molecular formula C10H7F2NO7 and a molecular weight of 291.16 g/mol. Its IUPAC name is 2-[6-(difluoromethoxy)-3-formyl-2-nitrophenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[6-(difluoromethoxy)-3-formyl-2-nitrophenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 171027691 |
| Molecular Formula | C10H7F2NO7 |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 2-[6-(difluoromethoxy)-3-formyl-2-nitrophenyl]-2-hydroxyacetic acid |
| SMILES | O=Cc1ccc(OC(F)F)c(C(O)C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7F2NO7/c11-10(12)20-5-2-1-4(3-14)7(13(18)19)6(5)8(15)9(16)17/h1-3,8,10,15H,(H,16,17) |
| InChIKey | HGSBZUNCOYHHTM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|