C10H6F2N2O6 — CID 171015832
2-[4-cyano-2-(difluoromethoxy)-6-nitrophenyl]-2-hydroxyacetic acid (PubChem CID 171015832) has the molecular formula C10H6F2N2O6 and a molecular weight of 288.16 g/mol. Its IUPAC name is 2-[4-cyano-2-(difluoromethoxy)-6-nitrophenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[4-cyano-2-(difluoromethoxy)-6-nitrophenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 171015832 |
| Molecular Formula | C10H6F2N2O6 |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-[4-cyano-2-(difluoromethoxy)-6-nitrophenyl]-2-hydroxyacetic acid |
| SMILES | N#Cc1cc(OC(F)F)c(C(O)C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H6F2N2O6/c11-10(12)20-6-2-4(3-13)1-5(14(18)19)7(6)8(15)9(16)17/h1-2,8,10,15H,(H,16,17) |
| InChIKey | MXWYPQBNBYCBFH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 133.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|