C10H6FNO4 — CID 171017192
2-(2-cyano-3-fluoro-6-formylphenyl)-2-hydroxyacetic acid (PubChem CID 171017192) has the molecular formula C10H6FNO4 and a molecular weight of 223.16 g/mol. Its IUPAC name is 2-(2-cyano-3-fluoro-6-formylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2-cyano-3-fluoro-6-formylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 171017192 |
| Molecular Formula | C10H6FNO4 |
| Molecular Weight | 223.16 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-(2-cyano-3-fluoro-6-formylphenyl)-2-hydroxyacetic acid |
| SMILES | N#Cc1c(F)ccc(C=O)c1C(O)C(=O)O |
| InChI | InChI=1S/C10H6FNO4/c11-7-2-1-5(4-13)8(6(7)3-12)9(14)10(15)16/h1-2,4,9,14H,(H,15,16) |
| InChIKey | AZEIMVZPQHGPGY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|