C11H9NO4 — CID 171017521
2-(2-cyano-3-formyl-5-methylphenyl)-2-hydroxyacetic acid (PubChem CID 171017521) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-(2-cyano-3-formyl-5-methylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2-cyano-3-formyl-5-methylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 171017521 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-(2-cyano-3-formyl-5-methylphenyl)-2-hydroxyacetic acid |
| SMILES | Cc1cc(C=O)c(C#N)c(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C11H9NO4/c1-6-2-7(5-13)9(4-12)8(3-6)10(14)11(15)16/h2-3,5,10,14H,1H3,(H,15,16) |
| InChIKey | BIWXLGVDUJOJHY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|