C10H7NO2 — CID 170996170
2,3-diformyl-5-methylbenzonitrile (PubChem CID 170996170) has the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. Its IUPAC name is 2,3-diformyl-5-methylbenzonitrile.
| Compound Name | 2,3-diformyl-5-methylbenzonitrile |
|---|---|
| PubChem CID | 170996170 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 2,3-diformyl-5-methylbenzonitrile |
| SMILES | Cc1cc(C#N)c(C=O)c(C=O)c1 |
| InChI | InChI=1S/C10H7NO2/c1-7-2-8(4-11)10(6-13)9(3-7)5-12/h2-3,5-6H,1H3 |
| InChIKey | FNQCEVIEWBKNFH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|