C10H9NO — CID 89039539
2-formyl-3,4-dimethylbenzonitrile (PubChem CID 89039539) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-formyl-3,4-dimethylbenzonitrile.
| Compound Name | 2-formyl-3,4-dimethylbenzonitrile |
|---|---|
| PubChem CID | 89039539 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 2-formyl-3,4-dimethylbenzonitrile |
| SMILES | Cc1ccc(C#N)c(C=O)c1C |
| InChI | InChI=1S/C10H9NO/c1-7-3-4-9(5-11)10(6-12)8(7)2/h3-4,6H,1-2H3 |
| InChIKey | NOYFYOWLSMWNOX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|