About 2-formyl-3,4-dihydroxybenzonitrile
2-formyl-3,4-dihydroxybenzonitrile (PubChem CID 175123640) has the molecular formula C8H5NO3
and a molecular weight of 163.13 g/mol. Its IUPAC name is 2-formyl-3,4-dihydroxybenzonitrile.
Molecular Properties
| Compound Name | 2-formyl-3,4-dihydroxybenzonitrile |
| PubChem CID | 175123640 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 2-formyl-3,4-dihydroxybenzonitrile |
| SMILES | N#Cc1ccc(O)c(O)c1C=O |
| InChI | InChI=1S/C8H5NO3/c9-3-5-1-2-7(11)8(12)6(5)4-10/h1-2,4,11-12H |
| InChIKey | HRSXTLDEVLCQKK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-formyl-3,4-dihydroxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formyl-3,4-dihydroxybenzonitrile?
The IUPAC name of 2-formyl-3,4-dihydroxybenzonitrile (CID 175123640) is 2-formyl-3,4-dihydroxybenzonitrile.
What is the SMILES notation for 2-formyl-3,4-dihydroxybenzonitrile?
The canonical SMILES for 2-formyl-3,4-dihydroxybenzonitrile is N#Cc1ccc(O)c(O)c1C=O.
What is the InChIKey of 2-formyl-3,4-dihydroxybenzonitrile?
The InChIKey is HRSXTLDEVLCQKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3/c9-3-5-1-2-7(11)8(12)6(5)4-10/h1-2,4,11-12H.
What are the key properties of 2-formyl-3,4-dihydroxybenzonitrile?
2-formyl-3,4-dihydroxybenzonitrile has a molecular weight of 163.13 g/mol, XLogP of 0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formyl-3,4-dihydroxybenzonitrile is sourced from PubChem (CID 175123640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).