C10H7NO3 — CID 171028234
3,4-diformyl-2-methoxybenzonitrile (PubChem CID 171028234) has the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. Its IUPAC name is 3,4-diformyl-2-methoxybenzonitrile.
| Compound Name | 3,4-diformyl-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 171028234 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 3,4-diformyl-2-methoxybenzonitrile |
| SMILES | COc1c(C#N)ccc(C=O)c1C=O |
| InChI | InChI=1S/C10H7NO3/c1-14-10-7(4-11)2-3-8(5-12)9(10)6-13/h2-3,5-6H,1H3 |
| InChIKey | CGUPUKJKYKZKJQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|