C14H11NO3 — CID 130385244
1-formyl-6,7-dimethoxynaphthalene-2-carbonitrile (PubChem CID 130385244) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-formyl-6,7-dimethoxynaphthalene-2-carbonitrile.
| Compound Name | 1-formyl-6,7-dimethoxynaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 130385244 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-formyl-6,7-dimethoxynaphthalene-2-carbonitrile |
| SMILES | COc1cc2ccc(C#N)c(C=O)c2cc1OC |
| InChI | InChI=1S/C14H11NO3/c1-17-13-5-9-3-4-10(7-15)12(8-16)11(9)6-14(13)18-2/h3-6,8H,1-2H3 |
| InChIKey | QRTNOEFKTLMFBE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|