C13H12O3 — CID 12583354
2,6-dimethoxynaphthalene-1-carbaldehyde (PubChem CID 12583354) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2,6-dimethoxynaphthalene-1-carbaldehyde.
| Compound Name | 2,6-dimethoxynaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 12583354 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2,6-dimethoxynaphthalene-1-carbaldehyde |
| SMILES | COc1ccc2c(C=O)c(OC)ccc2c1 |
| InChI | InChI=1S/C13H12O3/c1-15-10-4-5-11-9(7-10)3-6-13(16-2)12(11)8-14/h3-8H,1-2H3 |
| InChIKey | SZKBFOWEOKWEDD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|