C16H10F2O2 — CID 167713797
1,2-difluoro-7-methoxyphenanthrene-3-carbaldehyde (PubChem CID 167713797) has the molecular formula C16H10F2O2 and a molecular weight of 272.25 g/mol. Its IUPAC name is 1,2-difluoro-7-methoxyphenanthrene-3-carbaldehyde.
| Compound Name | 1,2-difluoro-7-methoxyphenanthrene-3-carbaldehyde |
|---|---|
| PubChem CID | 167713797 |
| Molecular Formula | C16H10F2O2 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1,2-difluoro-7-methoxyphenanthrene-3-carbaldehyde |
| SMILES | COc1ccc2c(ccc3c(F)c(F)c(C=O)cc32)c1 |
| InChI | InChI=1S/C16H10F2O2/c1-20-11-3-5-12-9(6-11)2-4-13-14(12)7-10(8-19)15(17)16(13)18/h2-8H,1H3 |
| InChIKey | DENHOEXMZKPSEA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|