C14H14O5S — CID 130391944
2,7-dimethoxy-6-methylsulfonylnaphthalene-1-carbaldehyde (PubChem CID 130391944) has the molecular formula C14H14O5S and a molecular weight of 294.33 g/mol. Its IUPAC name is 2,7-dimethoxy-6-methylsulfonylnaphthalene-1-carbaldehyde.
| Compound Name | 2,7-dimethoxy-6-methylsulfonylnaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 130391944 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2,7-dimethoxy-6-methylsulfonylnaphthalene-1-carbaldehyde |
| SMILES | COc1cc2c(C=O)c(OC)ccc2cc1S(C)(=O)=O |
| InChI | InChI=1S/C14H14O5S/c1-18-12-5-4-9-6-14(20(3,16)17)13(19-2)7-10(9)11(12)8-15/h4-8H,1-3H3 |
| InChIKey | HILFCWGPZRQFQU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|