C13H13BO5 — CID 18399681
(1-formyl-6,7-dimethoxynaphthalen-2-yl)boronic acid (PubChem CID 18399681) has the molecular formula C13H13BO5 and a molecular weight of 260.05 g/mol. Its IUPAC name is (1-formyl-6,7-dimethoxynaphthalen-2-yl)boronic acid.
| Compound Name | (1-formyl-6,7-dimethoxynaphthalen-2-yl)boronic acid |
|---|---|
| PubChem CID | 18399681 |
| Molecular Formula | C13H13BO5 |
| Molecular Weight | 260.05 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | (1-formyl-6,7-dimethoxynaphthalen-2-yl)boronic acid |
| SMILES | COc1cc2ccc(B(O)O)c(C=O)c2cc1OC |
| InChI | InChI=1S/C13H13BO5/c1-18-12-5-8-3-4-11(14(16)17)10(7-15)9(8)6-13(12)19-2/h3-7,16-17H,1-2H3 |
| InChIKey | VYTBQIRONXRBHT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.05 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|