C9H11BO5 — CID 74890628
(2-formyl-3,5-dimethoxyphenyl)boronic acid (PubChem CID 74890628) has the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. Its IUPAC name is (2-formyl-3,5-dimethoxyphenyl)boronic acid.
| Compound Name | (2-formyl-3,5-dimethoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 74890628 |
| Molecular Formula | C9H11BO5 |
| Molecular Weight | 209.99 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (2-formyl-3,5-dimethoxyphenyl)boronic acid |
| SMILES | COc1cc(OC)c(C=O)c(B(O)O)c1 |
| InChI | InChI=1S/C9H11BO5/c1-14-6-3-8(10(12)13)7(5-11)9(4-6)15-2/h3-5,12-13H,1-2H3 |
| InChIKey | CEDOKIIRVBABOG-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.99 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|