C10H11LiO3 — CID 10103889
lithium 2-methanidyl-4,6-dimethoxybenzaldehyde (PubChem CID 10103889) has the molecular formula C10H11LiO3 and a molecular weight of 186.14 g/mol. Its IUPAC name is lithium 2-methanidyl-4,6-dimethoxybenzaldehyde.
| Compound Name | lithium 2-methanidyl-4,6-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 10103889 |
| Molecular Formula | C10H11LiO3 |
| Molecular Weight | 186.14 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | lithium 2-methanidyl-4,6-dimethoxybenzaldehyde |
| SMILES | [CH2-]c1cc(OC)cc(OC)c1C=O.[Li+] |
| InChI | InChI=1S/C10H11O3.Li/c1-7-4-8(12-2)5-10(13-3)9(7)6-11;/h4-6H,1H2,2-3H3;/q-1;+1 |
| InChIKey | PSHRINZVWNQNPY-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.14 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|