C10H12FNO5S — CID 163366457
(NE)-N-[(2,4,6-trimethoxyphenyl)methylidene]sulfamoyl fluoride (PubChem CID 163366457) has the molecular formula C10H12FNO5S and a molecular weight of 277.27 g/mol. Its IUPAC name is (NE)-N-[(2,4,6-trimethoxyphenyl)methylidene]sulfamoyl fluoride.
| Compound Name | (NE)-N-[(2,4,6-trimethoxyphenyl)methylidene]sulfamoyl fluoride |
|---|---|
| PubChem CID | 163366457 |
| Molecular Formula | C10H12FNO5S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (NE)-N-[(2,4,6-trimethoxyphenyl)methylidene]sulfamoyl fluoride |
| SMILES | COc1cc(OC)c(/C=N/S(=O)(=O)F)c(OC)c1 |
| InChI | InChI=1S/C10H12FNO5S/c1-15-7-4-9(16-2)8(10(5-7)17-3)6-12-18(11,13)14/h4-6H,1-3H3/b12-6+ |
| InChIKey | OHQOXPAJCJESFF-WUXMJOGZSA-N |
| XLogP | 1.35 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|