C11H16N4O4 — CID 173236616
1,1-diamino-N-[(2,4,6-trimethoxyphenyl)methylideneamino]methanimine oxide (PubChem CID 173236616) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1,1-diamino-N-[(2,4,6-trimethoxyphenyl)methylideneamino]methanimine oxide.
| Compound Name | 1,1-diamino-N-[(2,4,6-trimethoxyphenyl)methylideneamino]methanimine oxide |
|---|---|
| PubChem CID | 173236616 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1,1-diamino-N-[(2,4,6-trimethoxyphenyl)methylideneamino]methanimine oxide |
| SMILES | COc1cc(OC)c(C=N[N+]([O-])=C(N)N)c(OC)c1 |
| InChI | InChI=1S/C11H16N4O4/c1-17-7-4-9(18-2)8(10(5-7)19-3)6-14-15(16)11(12)13/h4-6H,12-13H2,1-3H3 |
| InChIKey | UYZFESYFRCMLCC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|