C10H13N3O4 — CID 135679545
[(E)-(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]urea (PubChem CID 135679545) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is [(E)-(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]urea.
| Compound Name | [(E)-(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 135679545 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | [(E)-(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]urea |
| SMILES | COc1cc(O)c(/C=N/NC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C10H13N3O4/c1-16-6-3-8(14)7(9(4-6)17-2)5-12-13-10(11)15/h3-5,14H,1-2H3,(H3,11,13,15)/b12-5+ |
| InChIKey | VTGGOQXLARXFKH-LFYBBSHMSA-N |
| XLogP | 0.41 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|