C12H17NO4 — CID 136859318
2-(1-hydroxypropan-2-yliminomethyl)-3,5-dimethoxyphenol (PubChem CID 136859318) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-(1-hydroxypropan-2-yliminomethyl)-3,5-dimethoxyphenol.
| Compound Name | 2-(1-hydroxypropan-2-yliminomethyl)-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 136859318 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-(1-hydroxypropan-2-yliminomethyl)-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(/C=N/C(C)CO)c(OC)c1 |
| InChI | InChI=1S/C12H17NO4/c1-8(7-14)13-6-10-11(15)4-9(16-2)5-12(10)17-3/h4-6,8,14-15H,7H2,1-3H3/b13-6+ |
| InChIKey | JWFIEHKTGQXPBZ-AWNIVKPZSA-N |
| XLogP | 1.21 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|