C15H23NO4 — CID 136808100
2-[(1-hydroxy-3-methylpentan-2-yl)iminomethyl]-3,5-dimethoxyphenol (PubChem CID 136808100) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-[(1-hydroxy-3-methylpentan-2-yl)iminomethyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[(1-hydroxy-3-methylpentan-2-yl)iminomethyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 136808100 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[(1-hydroxy-3-methylpentan-2-yl)iminomethyl]-3,5-dimethoxyphenol |
| SMILES | CCC(C)C(CO)/N=C/c1c(O)cc(OC)cc1OC |
| InChI | InChI=1S/C15H23NO4/c1-5-10(2)13(9-17)16-8-12-14(18)6-11(19-3)7-15(12)20-4/h6-8,10,13,17-18H,5,9H2,1-4H3/b16-8+ |
| InChIKey | DUIKKHPNGMXAPH-LZYBPNLTSA-N |
| XLogP | 2.24 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|