C11H13ClO3 — CID 169478473
2-(3-chloroprop-1-enyl)-3,5-dimethoxyphenol (PubChem CID 169478473) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is 2-(3-chloroprop-1-enyl)-3,5-dimethoxyphenol.
| Compound Name | 2-(3-chloroprop-1-enyl)-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 169478473 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-(3-chloroprop-1-enyl)-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(C=CCCl)c(OC)c1 |
| InChI | InChI=1S/C11H13ClO3/c1-14-8-6-10(13)9(4-3-5-12)11(7-8)15-2/h3-4,6-7,13H,5H2,1-2H3 |
| InChIKey | BKSCAAMXOREWOA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|