C26H38FeN4O6 — CID 135456094
2-[3-[2-[3-[(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]propylamino]ethylamino]propyliminomethyl]-3,5-dimethoxyphenol;iron (PubChem CID 135456094) has the molecular formula C26H38FeN4O6 and a molecular weight of 558.46 g/mol. Its IUPAC name is 2-[3-[2-[3-[(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]propylamino]ethylamino]propyliminomethyl]-3,5-dimethoxyphenol;iron.
| Compound Name | 2-[3-[2-[3-[(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]propylamino]ethylamino]propyliminomethyl]-3,5-dimethoxyphenol;iron |
|---|---|
| PubChem CID | 135456094 |
| Molecular Formula | C26H38FeN4O6 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 2-[3-[2-[3-[(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]propylamino]ethylamino]propyliminomethyl]-3,5-dimethoxyphenol;iron |
| SMILES | COc1cc(O)c(/C=N\CCCNCCNCCC/N=C/c2c(O)cc(OC)cc2OC)c(OC)c1.[Fe] |
| InChI | InChI=1S/C26H38N4O6.Fe/c1-33-19-13-23(31)21(25(15-19)35-3)17-29-9-5-7-27-11-12-28-8-6-10-30-18-22-24(32)14-20(34-2)16-26(22)36-4;/h13-18,27-28,31-32H,5-12H2,1-4H3;/b29-17-,30-18+; |
| InChIKey | BHGWLMMOJGJGKM-RWSQMKIXSA-N |
| XLogP | 2.63 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|