C10H13N3O3S — CID 136717021
[(Z)-(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]thiourea (PubChem CID 136717021) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is [(Z)-(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]thiourea.
| Compound Name | [(Z)-(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 136717021 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | [(Z)-(2-hydroxy-4,6-dimethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cc(O)c(/C=N\NC(N)=S)c(OC)c1 |
| InChI | InChI=1S/C10H13N3O3S/c1-15-6-3-8(14)7(9(4-6)16-2)5-12-13-10(11)17/h3-5,14H,1-2H3,(H3,11,13,17)/b12-5- |
| InChIKey | JIGBFXJUFFHHGS-XGICHPGQSA-N |
| XLogP | 0.58 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|