C12H15N3O4S — CID 168534711
methyl 2-[(carbamothioylhydrazinylidene)methyl]-3,5-dimethoxybenzoate (PubChem CID 168534711) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is methyl 2-[(carbamothioylhydrazinylidene)methyl]-3,5-dimethoxybenzoate.
| Compound Name | methyl 2-[(carbamothioylhydrazinylidene)methyl]-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 168534711 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | methyl 2-[(carbamothioylhydrazinylidene)methyl]-3,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)cc(OC)c1C=NNC(N)=S |
| InChI | InChI=1S/C12H15N3O4S/c1-17-7-4-8(11(16)19-3)9(10(5-7)18-2)6-14-15-12(13)20/h4-6H,1-3H3,(H3,13,15,20) |
| InChIKey | XKQKJWZWPNZRJA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|