C11H15N3O3S — CID 7575205
[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]thiourea (PubChem CID 7575205) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is [(E)-(2,4,5-trimethoxyphenyl)methylideneamino]thiourea.
| Compound Name | [(E)-(2,4,5-trimethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 7575205 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [(E)-(2,4,5-trimethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cc(OC)c(OC)cc1/C=N/NC(N)=S |
| InChI | InChI=1S/C11H15N3O3S/c1-15-8-5-10(17-3)9(16-2)4-7(8)6-13-14-11(12)18/h4-6H,1-3H3,(H3,12,14,18)/b13-6+ |
| InChIKey | QJPAFWGJCOAXMT-AWNIVKPZSA-N |
| XLogP | 0.88 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|