C9H10N4O3S — CID 57359197
[(2-methoxy-5-nitrophenyl)methylideneamino]thiourea (PubChem CID 57359197) has the molecular formula C9H10N4O3S and a molecular weight of 254.27 g/mol. Its IUPAC name is [(2-methoxy-5-nitrophenyl)methylideneamino]thiourea.
| Compound Name | [(2-methoxy-5-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 57359197 |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | [(2-methoxy-5-nitrophenyl)methylideneamino]thiourea |
| SMILES | COc1ccc([N+](=O)[O-])cc1C=NNC(N)=S |
| InChI | InChI=1S/C9H10N4O3S/c1-16-8-3-2-7(13(14)15)4-6(8)5-11-12-9(10)17/h2-5H,1H3,(H3,10,12,17) |
| InChIKey | KCEYKZBLFJCPSZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|