C10H10N4O5S — CID 168534308
2-[2-[(carbamothioylhydrazinylidene)methyl]-4-nitrophenoxy]acetic acid (PubChem CID 168534308) has the molecular formula C10H10N4O5S and a molecular weight of 298.28 g/mol. Its IUPAC name is 2-[2-[(carbamothioylhydrazinylidene)methyl]-4-nitrophenoxy]acetic acid.
| Compound Name | 2-[2-[(carbamothioylhydrazinylidene)methyl]-4-nitrophenoxy]acetic acid |
|---|---|
| PubChem CID | 168534308 |
| Molecular Formula | C10H10N4O5S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-[2-[(carbamothioylhydrazinylidene)methyl]-4-nitrophenoxy]acetic acid |
| SMILES | NC(=S)NN=Cc1cc([N+](=O)[O-])ccc1OCC(=O)O |
| InChI | InChI=1S/C10H10N4O5S/c11-10(20)13-12-4-6-3-7(14(17)18)1-2-8(6)19-5-9(15)16/h1-4H,5H2,(H,15,16)(H3,11,13,20) |
| InChIKey | BFICAOMTHFGHDD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|