C12H14ClN3O4S — CID 168535799
2-[4-[(carbamothioylhydrazinylidene)methyl]-5-chloro-2-ethoxyphenoxy]acetic acid (PubChem CID 168535799) has the molecular formula C12H14ClN3O4S and a molecular weight of 331.78 g/mol. Its IUPAC name is 2-[4-[(carbamothioylhydrazinylidene)methyl]-5-chloro-2-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(carbamothioylhydrazinylidene)methyl]-5-chloro-2-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 168535799 |
| Molecular Formula | C12H14ClN3O4S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-[4-[(carbamothioylhydrazinylidene)methyl]-5-chloro-2-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(C=NNC(N)=S)c(Cl)cc1OCC(=O)O |
| InChI | InChI=1S/C12H14ClN3O4S/c1-2-19-9-3-7(5-15-16-12(14)21)8(13)4-10(9)20-6-11(17)18/h3-5H,2,6H2,1H3,(H,17,18)(H3,14,16,21) |
| InChIKey | CIHHNGMZOQLTOU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|