C10H10BrN3O3S — CID 57368044
2-[4-bromo-2-[(carbamothioylhydrazinylidene)methyl]phenoxy]acetic acid (PubChem CID 57368044) has the molecular formula C10H10BrN3O3S and a molecular weight of 332.18 g/mol. Its IUPAC name is 2-[4-bromo-2-[(carbamothioylhydrazinylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-bromo-2-[(carbamothioylhydrazinylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 57368044 |
| Molecular Formula | C10H10BrN3O3S |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 2-[4-bromo-2-[(carbamothioylhydrazinylidene)methyl]phenoxy]acetic acid |
| SMILES | NC(=S)NN=Cc1cc(Br)ccc1OCC(=O)O |
| InChI | InChI=1S/C10H10BrN3O3S/c11-7-1-2-8(17-5-9(15)16)6(3-7)4-13-14-10(12)18/h1-4H,5H2,(H,15,16)(H3,12,14,18) |
| InChIKey | XMIAPMUGGTWNDZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|