C14H17BrN4OS — CID 168535628
[[5-bromo-2-(5-cyanopentoxy)phenyl]methylideneamino]thiourea (PubChem CID 168535628) has the molecular formula C14H17BrN4OS and a molecular weight of 369.29 g/mol. Its IUPAC name is [[5-bromo-2-(5-cyanopentoxy)phenyl]methylideneamino]thiourea.
| Compound Name | [[5-bromo-2-(5-cyanopentoxy)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535628 |
| Molecular Formula | C14H17BrN4OS |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | [[5-bromo-2-(5-cyanopentoxy)phenyl]methylideneamino]thiourea |
| SMILES | N#CCCCCCOc1ccc(Br)cc1C=NNC(N)=S |
| InChI | InChI=1S/C14H17BrN4OS/c15-12-5-6-13(20-8-4-2-1-3-7-16)11(9-12)10-18-19-14(17)21/h5-6,9-10H,1-4,8H2,(H3,17,19,21) |
| InChIKey | PTVDZBGNZVUGTA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|