C16H18BrN5OS — CID 168627423
6-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-bromophenoxy]hexanenitrile (PubChem CID 168627423) has the molecular formula C16H18BrN5OS and a molecular weight of 408.33 g/mol. Its IUPAC name is 6-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-bromophenoxy]hexanenitrile.
| Compound Name | 6-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-bromophenoxy]hexanenitrile |
|---|---|
| PubChem CID | 168627423 |
| Molecular Formula | C16H18BrN5OS |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 6-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-bromophenoxy]hexanenitrile |
| SMILES | N#CCCCCCOc1ccc(Br)cc1C=NNc1nc(N)cs1 |
| InChI | InChI=1S/C16H18BrN5OS/c17-13-5-6-14(23-8-4-2-1-3-7-18)12(9-13)10-20-22-16-21-15(19)11-24-16/h5-6,9-11H,1-4,8,19H2,(H,21,22) |
| InChIKey | QBXRZLUFYTVSDW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|