C23H19BrN6O2 — CID 168572678
2-[2-[[5-bromo-2-(4-cyanobutoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572678) has the molecular formula C23H19BrN6O2 and a molecular weight of 491.35 g/mol. Its IUPAC name is 2-[2-[[5-bromo-2-(4-cyanobutoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[5-bromo-2-(4-cyanobutoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572678 |
| Molecular Formula | C23H19BrN6O2 |
| Molecular Weight | 491.35 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 2-[2-[[5-bromo-2-(4-cyanobutoxy)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#CCCCCOc1ccc(Br)cc1C=NNc1nc(-c2ccccc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C23H19BrN6O2/c24-18-9-10-20(32-12-6-2-5-11-25)17(13-18)15-27-30-23-28-21(16-7-3-1-4-8-16)19(14-26)22(31)29-23/h1,3-4,7-10,13,15H,2,5-6,12H2,(H2,28,29,30,31) |
| InChIKey | UNKKQTILVGOWHK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|