C20H14ClN5O4 — CID 168573281
2-[4-chloro-2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 168573281) has the molecular formula C20H14ClN5O4 and a molecular weight of 423.82 g/mol. Its IUPAC name is 2-[4-chloro-2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 168573281 |
| Molecular Formula | C20H14ClN5O4 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 2-[4-chloro-2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2cc(Cl)ccc2OCC(=O)O)[nH]c1=O |
| InChI | InChI=1S/C20H14ClN5O4/c21-14-6-7-16(30-11-17(27)28)13(8-14)10-23-26-20-24-18(12-4-2-1-3-5-12)15(9-22)19(29)25-20/h1-8,10H,11H2,(H,27,28)(H2,24,25,26,29) |
| InChIKey | XXXQUOXWYUQRBW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 140.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|