C27H22N6O4 — CID 168572521
2-[2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 168572521) has the molecular formula C27H22N6O4 and a molecular weight of 494.51 g/mol. Its IUPAC name is 2-[2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 168572521 |
| Molecular Formula | C27H22N6O4 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 2-[2-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccccc1C=NNc1nc(-c2ccccc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C27H22N6O4/c1-36-23-14-8-6-12-21(23)30-24(34)17-37-22-13-7-5-11-19(22)16-29-33-27-31-25(18-9-3-2-4-10-18)20(15-28)26(35)32-27/h2-14,16H,17H2,1H3,(H,30,34)(H2,31,32,33,35) |
| InChIKey | LNWSYTUMLIJRSR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|