C29H25BrN6O4 — CID 168572579
2-[5-bromo-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(2-phenylethyl)acetamide (PubChem CID 168572579) has the molecular formula C29H25BrN6O4 and a molecular weight of 601.46 g/mol. Its IUPAC name is 2-[5-bromo-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[5-bromo-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 168572579 |
| Molecular Formula | C29H25BrN6O4 |
| Molecular Weight | 601.46 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | 2-[5-bromo-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(2-phenylethyl)acetamide |
| SMILES | COc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)c(Br)cc1OCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C29H25BrN6O4/c1-39-24-14-21(23(30)15-25(24)40-18-26(37)32-13-12-19-8-4-2-5-9-19)17-33-36-29-34-27(20-10-6-3-7-11-20)22(16-31)28(38)35-29/h2-11,14-15,17H,12-13,18H2,1H3,(H,32,37)(H2,34,35,36,38) |
| InChIKey | UIVCVAGVDJHGSP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|