C21H17N5O5 — CID 168573650
2-[4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 168573650) has the molecular formula C21H17N5O5 and a molecular weight of 419.40 g/mol. Its IUPAC name is 2-[4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 168573650 |
| Molecular Formula | C21H17N5O5 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-[4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H17N5O5/c1-30-17-9-13(7-8-16(17)31-12-18(27)28)11-23-26-21-24-19(14-5-3-2-4-6-14)15(10-22)20(29)25-21/h2-9,11H,12H2,1H3,(H,27,28)(H2,24,25,26,29) |
| InChIKey | ZCWQCJZCFMUIOA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 149.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|