C34H45N5O3 — CID 168572027
2-[2-[(3,4-dioctoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572027) has the molecular formula C34H45N5O3 and a molecular weight of 571.77 g/mol. Its IUPAC name is 2-[2-[(3,4-dioctoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[(3,4-dioctoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572027 |
| Molecular Formula | C34H45N5O3 |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | 2-[2-[(3,4-dioctoxyphenyl)methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | CCCCCCCCOc1ccc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)cc1OCCCCCCCC |
| InChI | InChI=1S/C34H45N5O3/c1-3-5-7-9-11-16-22-41-30-21-20-27(24-31(30)42-23-17-12-10-8-6-4-2)26-36-39-34-37-32(28-18-14-13-15-19-28)29(25-35)33(40)38-34/h13-15,18-21,24,26H,3-12,16-17,22-23H2,1-2H3,(H2,37,38,39,40) |
| InChIKey | SLMQFFSBXJMSPU-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|