C33H26N6O4 — CID 168572641
2-[4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-diphenylacetamide (PubChem CID 168572641) has the molecular formula C33H26N6O4 and a molecular weight of 570.61 g/mol. Its IUPAC name is 2-[4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-diphenylacetamide.
| Compound Name | 2-[4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 168572641 |
| Molecular Formula | C33H26N6O4 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 2-[4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-diphenylacetamide |
| SMILES | COc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)ccc1OCC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H26N6O4/c1-42-29-19-23(21-35-38-33-36-31(24-11-5-2-6-12-24)27(20-34)32(41)37-33)17-18-28(29)43-22-30(40)39(25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-19,21H,22H2,1H3,(H2,36,37,38,41) |
| InChIKey | DZVXYLONKOEEII-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|