C24H17N7O5 — CID 168572787
2-[2-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572787) has the molecular formula C24H17N7O5 and a molecular weight of 483.44 g/mol. Its IUPAC name is 2-[2-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572787 |
| Molecular Formula | C24H17N7O5 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 2-[2-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cc(C=NNc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)ccc1Oc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H17N7O5/c1-35-20-12-15(9-10-19(20)36-23-18(31(33)34)8-5-11-26-23)14-27-30-24-28-21(16-6-3-2-4-7-16)17(13-25)22(32)29-24/h2-12,14H,1H3,(H2,28,29,30,32) |
| InChIKey | TXJTYRGSHBJPTD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 168.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|