C23H15N7O4 — CID 168571844
2-[2-[[4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571844) has the molecular formula C23H15N7O4 and a molecular weight of 453.42 g/mol. Its IUPAC name is 2-[2-[[4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571844 |
| Molecular Formula | C23H15N7O4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-[2-[[4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(Oc3ncccc3[N+](=O)[O-])cc2)[nH]c1=O |
| InChI | InChI=1S/C23H15N7O4/c24-13-18-20(16-5-2-1-3-6-16)27-23(28-21(18)31)29-26-14-15-8-10-17(11-9-15)34-22-19(30(32)33)7-4-12-25-22/h1-12,14H,(H2,27,28,29,31) |
| InChIKey | SKSBQLSWQUNBCV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|